EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H48N6O14 |
| Net Charge | 0 |
| Average Mass | 980.984 |
| Monoisotopic Mass | 980.32285 |
| SMILES | CC[C@@]1(OC(=O)[C@H](C)NC(=O)COCCOCC(=O)N[C@@H](C)C(=O)O[C@]2(CC)C(=O)OCc3c2cc2n(c3=O)Cc3cc4ccccc4nc3-2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C52H48N6O14/c1-5-51(35-19-39-43-31(17-29-11-7-9-13-37(29)55-43)21-57(39)45(61)33(35)23-69-49(51)65)71-47(63)27(3)53-41(59)25-67-15-16-68-26-42(60)54-28(4)48(64)72-52(6-2)36-20-40-44-32(18-30-12-8-10-14-38(30)56-44)22-58(40)46(62)34(36)24-70-50(52)66/h7-14,17-20,27-28H,5-6,15-16,21-26H2,1-4H3,(H,53,59)(H,54,60)/t27-,28-,51-,52-/m0/s1 |
| InChIKey | DZNNFZGDBUXWMV-ZUWDIFAMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pegamotecan (CHEBI:756088) has role antineoplastic agent (CHEBI:35610) |
| pegamotecan (CHEBI:756088) is a pyranoindolizinoquinoline (CHEBI:48626) |
| INN | Source |
|---|---|
| pegamotecan | WHO MedNet |
| Synonyms | Source |
|---|---|
| EZ-246 | ChEMBL |
| Peg-camptothecin | ChEMBL |
| Brand Name | Source |
|---|---|
| Prothecan | ChEMBL |