EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N4O3 |
| Net Charge | 0 |
| Average Mass | 330.388 |
| Monoisotopic Mass | 330.16919 |
| SMILES | COc1ccc(C(=O)[N-]c2c[n+](N3[C@H](C)CCC[C@@H]3C)no2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-12-5-4-6-13(2)21(12)20-11-16(24-19-20)18-17(22)14-7-9-15(23-3)10-8-14/h7-13H,4-6H2,1-3H3/t12-,13+ |
| InChIKey | TXPUBJSOHAMNEI-BETUJISGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirsidomine (CHEBI:756082) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| pirsidomina | WHO MedNet |
| pirsidomine | WHO MedNet |
| Synonyms | Source |
|---|---|
| CAS 936 | ChEMBL |
| CAS-936 | ChEMBL |