EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N3O5S |
| Net Charge | 0 |
| Average Mass | 399.513 |
| Monoisotopic Mass | 399.18279 |
| SMILES | [H][C@]12[C@@H](C)C(S[C@@H]3CN[C@]([H])([C@H](O)CCNC)C3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C18H29N3O5S/c1-8-14-13(9(2)22)17(24)21(14)15(18(25)26)16(8)27-10-6-11(20-7-10)12(23)4-5-19-3/h8-14,19-20,22-23H,4-7H2,1-3H3,(H,25,26)/t8-,9-,10+,11+,12-,13-,14-/m1/s1 |
| InChIKey | PZLOCBSBEUDCPF-YJIVIRPOSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenapenem (CHEBI:756074) is a carbapenems (CHEBI:46633) |
| INN | Source |
|---|---|
| lenapenem | WHO MedNet |