EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35NO4 |
| Net Charge | 0 |
| Average Mass | 437.580 |
| Monoisotopic Mass | 437.25661 |
| SMILES | [H][C@]1([C@@](C)(O)CCC)C[C@@]23C=C[C@]1(OC)[C@]1([H])Oc4c(O)ccc5c4[C@]21CCN(CC=C)[C@]3([H])C5 |
| InChI | InChI=1S/C27H35NO4/c1-5-9-24(3,30)19-16-25-10-11-27(19,31-4)23-26(25)12-14-28(13-6-2)20(25)15-17-7-8-18(29)22(32-23)21(17)26/h6-8,10-11,19-20,23,29-30H,2,5,9,12-16H2,1,3-4H3/t19-,20-,23-,24+,25-,26+,27-/m1/s1 |
| InChIKey | OSQIRUUENNTOQL-GCZKJHQNSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alletorphine (CHEBI:756070) is a morphinane alkaloid (CHEBI:25418) |
| INNs | Source |
|---|---|
| aletorfina | WHO MedNet |
| alletorphine | WHO MedNet |
| Synonyms | Source |
|---|---|
| R&S 218-M | ChEMBL |
| R&S-218-M | ChEMBL |
| R&S-218M | ChEMBL |