EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756067 - zabiciprilat
| Formula | C21H28N2O5 |
| Net Charge | 0 |
| Average Mass | 388.464 |
| Monoisotopic Mass | 388.19982 |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1C2CCC(CC2)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H28N2O5/c1-13(22-17(20(25)26)12-7-14-5-3-2-4-6-14)19(24)23-16-10-8-15(9-11-16)18(23)21(27)28/h2-6,13,15-18,22H,7-12H2,1H3,(H,25,26)(H,27,28)/t13-,15?,16?,17-,18-/m0/s1 |
| InChIKey | HBZJVGFXZTUXNI-XMQLQKOFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zabiciprilat (CHEBI:756067) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| zabiciprilat | WHO MedNet |
| zabiciprilate | WHO MedNet |