EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756064 - salmisteine
| Formula | C14H15NO6S |
| Net Charge | 0 |
| Average Mass | 325.342 |
| Monoisotopic Mass | 325.06201 |
| SMILES | CC(=O)N[C@@H](CSC(=O)c1ccccc1OC(C)=O)C(=O)O |
| InChI | InChI=1S/C14H15NO6S/c1-8(16)15-11(13(18)19)7-22-14(20)10-5-3-4-6-12(10)21-9(2)17/h3-6,11H,7H2,1-2H3,(H,15,16)(H,18,19)/t11-/m0/s1 |
| InChIKey | QLOBGRBOWVVKIE-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salmisteine (CHEBI:756064) is a N-acyl-amino acid (CHEBI:51569) |
| INNs | Source |
|---|---|
| salmisteina | WHO MedNet |
| salmisteine | WHO MedNet |