EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24N8O2 |
| Net Charge | 0 |
| Average Mass | 528.576 |
| Monoisotopic Mass | 528.20222 |
| SMILES | C[C@H](NC(=O)c1c(N)nn2cccnc12)c1cc2cccc(C#Cc3cnn(C)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H24N8O2/c1-19(34-29(39)26-27(31)35-37-15-7-14-32-28(26)37)24-16-22-9-6-8-21(13-12-20-17-33-36(2)18-20)25(22)30(40)38(24)23-10-4-3-5-11-23/h3-11,14-19H,1-2H3,(H2,31,35)(H,34,39)/t19-/m0/s1 |
| InChIKey | XUMALORDVCFWKV-IBGZPJMESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eganelisib (CHEBI:756025) has role antineoplastic agent (CHEBI:35610) |
| eganelisib (CHEBI:756025) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| eganelisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| IPI-549 | ChEMBL |
| Pi3k-gamma inhibitor ipi-549 | ChEMBL |
| Citations |
|---|