EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23N5O2 |
| Net Charge | 0 |
| Average Mass | 437.503 |
| Monoisotopic Mass | 437.18517 |
| SMILES | Cc1noc(C)c1-c1cc(C(O)(c2ccccn2)c2ccccn2)c2nc(C3CC3)nc2c1 |
| InChI | InChI=1S/C26H23N5O2/c1-15-23(16(2)33-31-15)18-13-19(24-20(14-18)29-25(30-24)17-9-10-17)26(32,21-7-3-5-11-27-21)22-8-4-6-12-28-22/h3-8,11-14,17,32H,9-10H2,1-2H3,(H,29,30) |
| InChIKey | CMSUJGUHYXQSOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alobresib (CHEBI:756024) has role antineoplastic agent (CHEBI:35610) |
| alobresib (CHEBI:756024) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| alobresib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gs 5829 | ChEMBL |
| Gs-5829 | ChEMBL |