EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25F3N4O |
| Net Charge | 0 |
| Average Mass | 418.463 |
| Monoisotopic Mass | 418.19805 |
| SMILES | CC(C)(O)[C@H]1CC[C@H](Nc2ccc3ncc(-c4cccc(C(F)(F)F)c4)n3n2)CC1 |
| InChI | InChI=1S/C22H25F3N4O/c1-21(2,30)15-6-8-17(9-7-15)27-19-10-11-20-26-13-18(29(20)28-19)14-4-3-5-16(12-14)22(23,24)25/h3-5,10-13,15,17,30H,6-9H2,1-2H3,(H,27,28)/t15-,17- |
| InChIKey | XRNVABDYQLHODA-JCNLHEQBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nuvisertib (CHEBI:756018) has role antineoplastic agent (CHEBI:35610) |
| nuvisertib (CHEBI:756018) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| nuvisertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| SGI-9481 | ChEMBL |
| SGI9481 | ChEMBL |
| TP-3654 | ChEMBL |
| TP3654 | ChEMBL |
| Citations |
|---|