EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21F5N4O2 |
| Net Charge | 0 |
| Average Mass | 456.415 |
| Monoisotopic Mass | 456.15847 |
| SMILES | CC(=O)N1CCc2c(nnc2C(=O)N2CCC(c3ccc(F)c(F)c3C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C21H21F5N4O2/c1-11(31)30-9-6-14-16(10-30)27-28-19(14)20(32)29-7-4-12(5-8-29)13-2-3-15(22)18(23)17(13)21(24,25)26/h2-3,12H,4-10H2,1H3,(H,27,28) |
| InChIKey | HAGSLCBZFRRBLS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinlarebant (CHEBI:756015) has role ophthalmology drug (CHEBI:66981) |
| tinlarebant (CHEBI:756015) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| tinlarebant | WHO MedNet |
| Synonyms | Source |
|---|---|
| BPN-14967 | ChEMBL |
| LBS-008 | ChEMBL |