EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N6O3S |
| Net Charge | 0 |
| Average Mass | 466.567 |
| Monoisotopic Mass | 466.17871 |
| SMILES | COCc1c(-c2cc3cc(C)cc(OC)c3s2)c2c(N)ncnn2c1CN1CCNC(=O)C1 |
| InChI | InChI=1S/C23H26N6O3S/c1-13-6-14-8-18(33-22(14)17(7-13)32-3)20-15(11-31-2)16(9-28-5-4-25-19(30)10-28)29-21(20)23(24)26-12-27-29/h6-8,12H,4-5,9-11H2,1-3H3,(H,25,30)(H2,24,26,27) |
| InChIKey | HNLRRJSKGXOYNO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rogaratinib (CHEBI:756014) has role antineoplastic agent (CHEBI:35610) |
| rogaratinib (CHEBI:756014) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| rogaratinib | WHO MedNet |
| Synonym | Source |
|---|---|
| BAY-1163877 | ChEMBL |
| Citations |
|---|