EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19ClF3N3O4 |
| Net Charge | 0 |
| Average Mass | 457.836 |
| Monoisotopic Mass | 457.10162 |
| SMILES | COc1nc(N(CC(C)(C)F)c2cc(Cl)c(F)cc2F)cnc1C(=O)[C@H]1C[C@@H]1C(=O)O |
| InChI | InChI=1S/C20H19ClF3N3O4/c1-20(2,24)8-27(14-5-11(21)12(22)6-13(14)23)15-7-25-16(18(26-15)31-3)17(28)9-4-10(9)19(29)30/h5-7,9-10H,4,8H2,1-3H3,(H,29,30)/t9-,10-/m0/s1 |
| InChIKey | RVMWIVNHZMXEHS-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-9898 (CHEBI:756012) has role anti-asthmatic agent (CHEBI:65023) |
| azd-9898 (CHEBI:756012) is a aromatic amine (CHEBI:33860) |
| azd-9898 (CHEBI:756012) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| Azd-9898 | ChEMBL |
| Azd9898 | ChEMBL |
| Citations |
|---|