EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27N7O3 |
| Net Charge | 0 |
| Average Mass | 473.537 |
| Monoisotopic Mass | 473.21754 |
| SMILES | Cn1cc(-c2ccc(=O)n(Cc3cccc(-c4ncc(OCCN5CCOCC5)cn4)c3)n2)cn1 |
| InChI | InChI=1S/C25H27N7O3/c1-30-18-21(14-28-30)23-5-6-24(33)32(29-23)17-19-3-2-4-20(13-19)25-26-15-22(16-27-25)35-12-9-31-7-10-34-11-8-31/h2-6,13-16,18H,7-12,17H2,1H3 |
| InChIKey | CIUKPBWULKEZMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emd-1204831 (CHEBI:756011) has role antineoplastic agent (CHEBI:35610) |
| emd-1204831 (CHEBI:756011) is a pyridazinone (CHEBI:26414) |
| Synonym | Source |
|---|---|
| Emd-1204831 | ChEMBL |