EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38ClN7O3 |
| Net Charge | 0 |
| Average Mass | 580.133 |
| Monoisotopic Mass | 579.27247 |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2OC)CCC[C@H](N2CCN(CCO)CC2)C3)ncc1Cl |
| InChI | InChI=1S/C30H38ClN7O3/c1-32-29(40)23-7-3-4-9-25(23)34-28-24(31)19-33-30(36-28)35-26-11-10-20-18-21(6-5-8-22(20)27(26)41-2)38-14-12-37(13-15-38)16-17-39/h3-4,7,9-11,19,21,39H,5-6,8,12-18H2,1-2H3,(H,32,40)(H2,33,34,35,36)/t21-/m0/s1 |
| InChIKey | BCSHRERPHLTPEE-NRFANRHFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cep-37440 (CHEBI:756008) has role antineoplastic agent (CHEBI:35610) |
| cep-37440 (CHEBI:756008) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Alk-fak inhibitor cep-37440 | ChEMBL |
| Cep-37440 | ChEMBL |
| Citations |
|---|