EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27ClN6O2 |
| Net Charge | 0 |
| Average Mass | 406.918 |
| Monoisotopic Mass | 406.18840 |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCn2ccnn2)CC1 |
| InChI | InChI=1S/C19H27ClN6O2/c1-28-18-12-17(21)16(20)11-15(18)19(27)22-13-14-3-8-25(9-4-14)6-2-7-26-10-5-23-24-26/h5,10-12,14H,2-4,6-9,13,21H2,1H3,(H,22,27) |
| InChIKey | AULLTYAISZREAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| da-6886 (CHEBI:756007) has role antispasmodic drug (CHEBI:53784) |
| da-6886 (CHEBI:756007) is a carbonyl compound (CHEBI:36586) |
| da-6886 (CHEBI:756007) is a organohalogen compound (CHEBI:17792) |
| Synonym | Source |
|---|---|
| Da-6886 | ChEMBL |