EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756004 - murepavadin
| Formula | C73H112N22O16 |
| Net Charge | 0 |
| Average Mass | 1553.837 |
| Monoisotopic Mass | 1552.86267 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@]1([H])CCCN1C(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](Cc1cnc3ccccc13)NC(=O)[C@H](CCN)NC(=O)[C@@H](CCN)NC(=O)[C@H](CCCN)NC(=O)[C@H](CCN)NC(=O)[C@]([H])([C@@H](C)CC)NC(=O)[C@H](Cc1cnc3ccccc13)NC(=O)[C@]([H])([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C73H112N22O16/c1-5-38(2)58-70(108)88-52(24-30-79)65(103)83-47(17-10-25-74)62(100)85-49(21-27-76)63(101)86-51(23-29-78)66(104)89-53(33-41-35-80-45-15-8-6-13-43(41)45)67(105)87-50(22-28-77)64(102)84-48(20-26-75)61(99)82-39(3)60(98)91-55(37-96)72(110)95-32-12-19-57(95)73(111)94-31-11-18-56(94)69(107)93-59(40(4)97)71(109)90-54(68(106)92-58)34-42-36-81-46-16-9-7-14-44(42)46/h6-9,13-16,35-36,38-40,47-59,80-81,96-97H,5,10-12,17-34,37,74-79H2,1-4H3,(H,82,99)(H,83,103)(H,84,102)(H,85,100)(H,86,101)(H,87,105)(H,88,108)(H,89,104)(H,90,109)(H,91,98)(H,92,106)(H,93,107)/t38-,39-,40+,47-,48-,49+,50-,51-,52-,53-,54-,55-,56-,57+,58-,59-/m0/s1 |
| InChIKey | RIDRXGOBXZLKHZ-NZUANIILSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| murepavadin (CHEBI:756004) has role antimicrobial agent (CHEBI:33281) |
| murepavadin (CHEBI:756004) has role renoprotective agent (CHEBI:231911) |
| murepavadin (CHEBI:756004) is a oligopeptide (CHEBI:25676) |
| INNs | Source |
|---|---|
| murepavadin | WHO MedNet |
| murepavadina | WHO MedNet |
| murepavadine | WHO MedNet |
| Synonyms | Source |
|---|---|
| POL-7080 | ChEMBL |
| POL7080 | ChEMBL |
| RO-7033877 | ChEMBL |
| RO7033877 | ChEMBL |
| Citations |
|---|