EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8BrN7 |
| Net Charge | 0 |
| Average Mass | 294.116 |
| Monoisotopic Mass | 293.00246 |
| SMILES | C#CCNc1nc(-n2cncn2)nc(N)c1Br |
| InChI | InChI=1S/C9H8BrN7/c1-2-3-13-8-6(10)7(11)15-9(16-8)17-5-12-4-14-17/h1,4-5H,3H2,(H3,11,13,15,16) |
| InChIKey | OQCWNHHZPYJHQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pbf-999 (CHEBI:756001) has role antineoplastic agent (CHEBI:35610) |
| pbf-999 (CHEBI:756001) is a organohalogen compound (CHEBI:17792) |
| pbf-999 (CHEBI:756001) is a pyrimidines (CHEBI:39447) |
| Synonyms | Source |
|---|---|
| Pbf 999 | ChEMBL |
| Pbf-999 | ChEMBL |
| PBF999 | ChEMBL |