EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756000 - acoramidis
| Formula | C15H17FN2O3 |
| Net Charge | 0 |
| Average Mass | 292.310 |
| Monoisotopic Mass | 292.12232 |
| SMILES | Cc1nnc(C)c1CCCOc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C15H17FN2O3/c1-9-12(10(2)18-17-9)4-3-7-21-14-8-11(15(19)20)5-6-13(14)16/h5-6,8H,3-4,7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | WBFUHHBPNXWNCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acoramidis (CHEBI:756000) has role cardiovascular drug (CHEBI:35554) |
| acoramidis (CHEBI:756000) is a benzoic acids (CHEBI:22723) |
| acoramidis (CHEBI:756000) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| Acoramidis | ChEMBL |
| AG-10 | ChEMBL |
| AG10 | ChEMBL |
| Citations |
|---|