EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | C/C=C1/CC2=C(C(=O)OC2=O)[C@@H](CCC)[C@H](O)C(=O)C[C@@H]1O |
| InChI | InChI=1S/C16H20O6/c1-3-5-9-13-10(15(20)22-16(13)21)6-8(4-2)11(17)7-12(18)14(9)19/h4,9,11,14,17,19H,3,5-7H2,1-2H3/b8-4-/t9-,11+,14+/m1/s1 |
| InChIKey | ILMHTGUGRLGMCR-LRIVTRFWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-dihydroxycornestin (CHEBI:756) has role herbicide (CHEBI:24527) |
| 14-dihydroxycornestin (CHEBI:756) has role metabolite (CHEBI:25212) |
| 14-dihydroxycornestin (CHEBI:756) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| 14-dihydroxycornestin (CHEBI:756) is a organic heterobicyclic compound (CHEBI:27171) |
| 14-dihydroxycornestin (CHEBI:756) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (4R,5S,8S,9Z)-9-ethylidene-5,8-dihydroxy-4-propyl-4,5,7,8,9,10-hexahydro-1H-cyclonona[c]furan-1,3,6-trione |
| Synonym | Source |
|---|---|
| Cornexistin | KEGG COMPOUND |
| Citations |
|---|