EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N3O4 |
| Net Charge | 0 |
| Average Mass | 369.421 |
| Monoisotopic Mass | 369.16886 |
| SMILES | CC(C)(N)[C@H](NC(=O)c1ccc(C#CC#C[C@@H]2C[C@H]2CO)cc1)C(=O)NO |
| InChI | InChI=1S/C20H23N3O4/c1-20(2,21)17(19(26)23-27)22-18(25)14-9-7-13(8-10-14)5-3-4-6-15-11-16(15)12-24/h7-10,15-17,24,27H,11-12,21H2,1-2H3,(H,22,25)(H,23,26)/t15-,16+,17-/m1/s1 |
| InChIKey | GOCUUDXEOKIQRU-IXDOHACOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| achn-975 (CHEBI:755998) is a N-acylglycine (CHEBI:16180) |
| Synonym | Source |
|---|---|
| ACHN-975 | ChEMBL |
| Citations |
|---|