EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C13H13N8O2 |
| Net Charge | 0 |
| Average Mass | 336.291 |
| Monoisotopic Mass | 336.10592 |
| SMILES | [Na+].[O-]c1c(-n2ccnn2)cnn1-c1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C13H14N8O2.Na/c22-13-10(20-2-1-16-18-20)8-17-21(13)12-7-11(14-9-15-12)19-3-5-23-6-4-19;/h1-2,7-9,22H,3-6H2;/q;+1/p-1 |
| InChIKey | VYRQLKYGGSWDNH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| molidustat sodium (CHEBI:755992) has role anti-anaemic agent (CHEBI:75835) |
| molidustat sodium (CHEBI:755992) is a dialkylarylamine (CHEBI:23665) |
| molidustat sodium (CHEBI:755992) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| BAY 1053048 | ChEMBL |
| BAY-1053048 | ChEMBL |
| BAY-85-3934 SODIUM | ChEMBL |
| Molidustat sodium | ChEMBL |