EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16F4N6O2 |
| Net Charge | 0 |
| Average Mass | 472.402 |
| Monoisotopic Mass | 472.12709 |
| SMILES | O=C(c1cc(Cc2nnc(=O)c3ccccc23)ccc1F)N1CCn2nc(C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C22H16F4N6O2/c23-16-6-5-12(10-17-13-3-1-2-4-14(13)19(33)29-28-17)9-15(16)20(34)31-7-8-32-18(11-31)27-21(30-32)22(24,25)26/h1-6,9H,7-8,10-11H2,(H,29,33) |
| InChIKey | XJGXCBHXFWBOTN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluzoparib (CHEBI:755990) has role antineoplastic agent (CHEBI:35610) |
| fluzoparib (CHEBI:755990) has role renoprotective agent (CHEBI:231911) |
| fluzoparib (CHEBI:755990) is a phthalazines (CHEBI:38768) |
| INN | Source |
|---|---|
| fuzuloparib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fluzoparib | ChEMBL |
| Fuzuopali | ChEMBL |
| HS-10160 | ChEMBL |
| HS10160 | ChEMBL |
| SHR-3162 | ChEMBL |
| SHR3162 | ChEMBL |
| Citations |
|---|