EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N8O |
| Net Charge | 0 |
| Average Mass | 446.559 |
| Monoisotopic Mass | 446.25426 |
| SMILES | CCOc1cc(-c2nncn2C)ccc1Nc1ncc2cc(C)nc(NCC(C)(C)C)c2n1 |
| InChI | InChI=1S/C24H30N8O/c1-7-33-19-11-16(22-31-27-14-32(22)6)8-9-18(19)29-23-25-12-17-10-15(2)28-21(20(17)30-23)26-13-24(3,4)5/h8-12,14H,7,13H2,1-6H3,(H,26,28)(H,25,29,30) |
| InChIKey | SGWLRDAOCLITOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bos-172722 (CHEBI:755987) has role antineoplastic agent (CHEBI:35610) |
| bos-172722 (CHEBI:755987) is a triazoles (CHEBI:35727) |
| Synonyms | Source |
|---|---|
| Bos-172722 | ChEMBL |
| Bos172722 | ChEMBL |
| Citations |
|---|