EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755986 - amredobresib
| Formula | C26H29N9 |
| Net Charge | 0 |
| Average Mass | 467.581 |
| Monoisotopic Mass | 467.25459 |
| SMILES | CNc1nc(-c2nc3ccc(N4CCN(C)CC4)cc3n2Cc2ccccc2)cn2c(C)nnc12 |
| InChI | InChI=1S/C26H29N9/c1-18-30-31-26-24(27-2)28-22(17-34(18)26)25-29-21-10-9-20(33-13-11-32(3)12-14-33)15-23(21)35(25)16-19-7-5-4-6-8-19/h4-10,15,17H,11-14,16H2,1-3H3,(H,27,28) |
| InChIKey | JLUUVUUYIXBDCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amredobresib (CHEBI:755986) has role antineoplastic agent (CHEBI:35610) |
| amredobresib (CHEBI:755986) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| amredobresib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BI-894999 | ChEMBL |
| BI894999 | ChEMBL |
| Citations |
|---|