EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22ClF3N4O2 |
| Net Charge | 0 |
| Average Mass | 502.924 |
| Monoisotopic Mass | 502.13834 |
| SMILES | C[C@H](NC(=O)CCc1nc2cccnc2n1Cc1ccc(OC(F)(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClF3N4O2/c1-16(18-6-8-19(26)9-7-18)31-23(34)13-12-22-32-21-3-2-14-30-24(21)33(22)15-17-4-10-20(11-5-17)35-25(27,28)29/h2-11,14,16H,12-13,15H2,1H3,(H,31,34)/t16-/m0/s1 |
| InChIKey | HXYXHSDYBDFOFO-INIZCTEOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cambritaxestat (CHEBI:755985) has role antineoplastic agent (CHEBI:35610) |
| cambritaxestat (CHEBI:755985) is a imidazopyridine (CHEBI:46908) |
| INN | Source |
|---|---|
| cambritaxestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| CRT0273750 | ChEMBL |
| IOA-289 | ChEMBL |
| IOA289 | ChEMBL |
| Citations |
|---|