EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18FN3O5 |
| Net Charge | 0 |
| Average Mass | 399.378 |
| Monoisotopic Mass | 399.12305 |
| SMILES | CNC(=O)C[C@H]1COc2cc(F)ccc2N1C(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C20H18FN3O5/c1-22-18(25)8-13-9-28-17-7-12(21)3-4-15(17)24(13)20(27)11-2-5-16-14(6-11)23-19(26)10-29-16/h2-7,13H,8-10H2,1H3,(H,22,25)(H,23,26)/t13-/m0/s1 |
| InChIKey | MBKYLPOPYYLTNW-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balcinrenone (CHEBI:755984) has role cardiovascular drug (CHEBI:35554) |
| balcinrenone (CHEBI:755984) has role renoprotective agent (CHEBI:231911) |
| balcinrenone (CHEBI:755984) is a benzoxazine (CHEBI:46969) |
| INNs | Source |
|---|---|
| balcinrenona | WHO MedNet |
| balcinrenone | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd 9977 | ChEMBL |
| AZD-9977 | ChEMBL |
| AZD9977 | ChEMBL |
| Citations |
|---|