EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755980 - ly2881835
| Formula | C33H33NO3 |
| Net Charge | 0 |
| Average Mass | 491.631 |
| Monoisotopic Mass | 491.24604 |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCC4(C=Cc5ccccc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H33NO3/c1-2-5-29(22-32(35)36)27-12-14-30(15-13-27)37-24-26-10-8-25(9-11-26)23-34-20-18-33(19-21-34)17-16-28-6-3-4-7-31(28)33/h3-4,6-17,29H,18-24H2,1H3,(H,35,36)/t29-/m0/s1 |
| InChIKey | FHRWHNJJQGSCQC-LJAQVGFWSA-N |
| Roles Classification |
|---|
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly2881835 (CHEBI:755980) has role hypoglycemic agent (CHEBI:35526) |
| ly2881835 (CHEBI:755980) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| LY-2881835 | ChEMBL |
| LY2881835 | ChEMBL |
| Citations |
|---|