EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12F5N7O |
| Net Charge | 0 |
| Average Mass | 425.321 |
| Monoisotopic Mass | 425.10235 |
| SMILES | C[C@H]1Cc2c(nnn2-c2ncc(F)cn2)CN1C(=O)c1ccnc(C(F)(F)F)c1F |
| InChI | InChI=1S/C17H12F5N7O/c1-8-4-12-11(26-27-29(12)16-24-5-9(18)6-25-16)7-28(8)15(30)10-2-3-23-14(13(10)19)17(20,21)22/h2-3,5-6,8H,4,7H2,1H3/t8-/m0/s1 |
| InChIKey | LMDWZBQISRTEBH-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zanvipixant (CHEBI:755979) has role antipsychotic agent (CHEBI:35476) |
| zanvipixant (CHEBI:755979) is a aromatic carboxylic acid (CHEBI:33859) |
| zanvipixant (CHEBI:755979) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INN | Source |
|---|---|
| zanvipixant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Jnj-55308942 | ChEMBL |
| JNJ55308942 | ChEMBL |
| Citations |
|---|