EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25F7N4O3 |
| Net Charge | 0 |
| Average Mass | 574.497 |
| Monoisotopic Mass | 574.18149 |
| SMILES | Cc1cccc2c1NC(=O)[C@@H](NC(=O)[C@H](CCC(F)(F)F)[C@H](CCC(F)(F)F)C(N)=O)N=C2c1cccc(F)c1 |
| InChI | InChI=1S/C26H25F7N4O3/c1-13-4-2-7-18-19(13)36-24(40)22(35-20(18)14-5-3-6-15(27)12-14)37-23(39)17(9-11-26(31,32)33)16(21(34)38)8-10-25(28,29)30/h2-7,12,16-17,22H,8-11H2,1H3,(H2,34,38)(H,36,40)(H,37,39)/t16-,17+,22+/m0/s1 |
| InChIKey | SRJNRAQUSAVENA-GSHUGGBRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| varegacestat (CHEBI:755976) has role antineoplastic agent (CHEBI:35610) |
| varegacestat (CHEBI:755976) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| varegacestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bms 986115 | ChEMBL |
| Bms-986115 | ChEMBL |