EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N8O4 |
| Net Charge | 0 |
| Average Mass | 506.567 |
| Monoisotopic Mass | 506.23900 |
| SMILES | COCCNc1cc(NC(=O)N2CCCc3cc(CN4CCN(C)CC4=O)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C25H30N8O4/c1-31-7-8-32(23(35)15-31)14-18-10-17-4-3-6-33(24(17)29-21(18)16-34)25(36)30-22-11-20(27-5-9-37-2)19(12-26)13-28-22/h10-11,13,16H,3-9,14-15H2,1-2H3,(H2,27,28,30,36) |
| InChIKey | BHKDKKZMPODMIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fgf401 (CHEBI:755973) has role antineoplastic agent (CHEBI:35610) |
| fgf401 (CHEBI:755973) is a naphthyridine derivative (CHEBI:73539) |
| INN | Source |
|---|---|
| roblitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fgf401 | ChEMBL |
| FGF-401 | ChEMBL |
| Citations |
|---|