EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19ClF3NO5 |
| Net Charge | 0 |
| Average Mass | 469.843 |
| Monoisotopic Mass | 469.09039 |
| SMILES | CN1CC[C@@H](c2c(O)cc(O)c3c(=O)cc(-c4ccc(C(F)(F)F)cc4Cl)oc23)[C@@H]1CO |
| InChI | InChI=1S/C22H19ClF3NO5/c1-27-5-4-12(14(27)9-28)19-15(29)7-16(30)20-17(31)8-18(32-21(19)20)11-3-2-10(6-13(11)23)22(24,25)26/h2-3,6-8,12,14,28-30H,4-5,9H2,1H3/t12-,14+/m1/s1 |
| InChIKey | MRPGRAKIAJJGMM-OCCSQVGLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| voruciclib (CHEBI:755971) has role antineoplastic agent (CHEBI:35610) |
| voruciclib (CHEBI:755971) is a hydroxyflavonoid (CHEBI:71968) |
| INN | Source |
|---|---|
| voruciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| P-1446 | ChEMBL |
| P1446a-05 | ChEMBL |
| Citations |
|---|