EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755968 - brensocatib
| Formula | C23H24N4O4 |
| Net Charge | 0 |
| Average Mass | 420.469 |
| Monoisotopic Mass | 420.17976 |
| SMILES | Cn1c(=O)oc2ccc(-c3ccc(C[C@@H](C#N)NC(=O)[C@@H]4CNCCCO4)cc3)cc21 |
| InChI | InChI=1S/C23H24N4O4/c1-27-19-12-17(7-8-20(19)31-23(27)29)16-5-3-15(4-6-16)11-18(13-24)26-22(28)21-14-25-9-2-10-30-21/h3-8,12,18,21,25H,2,9-11,14H2,1H3,(H,26,28)/t18-,21-/m0/s1 |
| InChIKey | AEXFXNFMSAAELR-RXVVDRJESA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brensocatib (CHEBI:755968) has functional parent β-amino acid (CHEBI:33706) |
| brensocatib (CHEBI:755968) has role antiviral agent (CHEBI:22587) |
| brensocatib (CHEBI:755968) has role renoprotective agent (CHEBI:231911) |
| brensocatib (CHEBI:755968) is a organonitrogen compound (CHEBI:35352) |
| brensocatib (CHEBI:755968) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| brensocatib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZD 7986 | ChEMBL |
| AZD-7986 | ChEMBL |
| AZD7986 | ChEMBL |
| INS-1007 | ChEMBL |
| INS1007 | ChEMBL |
| Citations |
|---|