EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22F2N6O2 |
| Net Charge | 0 |
| Average Mass | 428.443 |
| Monoisotopic Mass | 428.17723 |
| SMILES | O=C(Nc1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)nc12)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C21H22F2N6O2/c22-13-3-4-16(23)15(10-13)18-2-1-7-28(18)19-6-9-29-20(26-19)17(11-24-29)25-21(31)27-8-5-14(30)12-27/h3-4,6,9-11,14,18,30H,1-2,5,7-8,12H2,(H,25,31)/t14-,18+/m0/s1 |
| InChIKey | NYNZQNWKBKUAII-KBXCAEBGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| larotrectinib (CHEBI:755964) has role antineoplastic agent (CHEBI:35610) |
| larotrectinib (CHEBI:755964) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| ARRY-470 | ChEMBL |
| BAY-2757556 | ChEMBL |
| BAY2757556 | ChEMBL |
| Larotrectinib | ChEMBL |
| LOXO-101 | ChEMBL |
| Citations |
|---|