EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.B4O7.Na.Na.H2O.H2O.H2O.H2O.H2O.H2O.H2O.H2O.H2O |
| Net Charge | 0 |
| Average Mass | 381.371 |
| Monoisotopic Mass | 382.08681 |
| SMILES | O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]B1OB2OB([O-])OB(O1)O2 |
| InChI | InChI=1S/B4O7.2Na.10H2O/c5-1-7-3-9-2(6)10-4(8-1)11-3;;;;;;;;;;;;/h;;;10*1H2/q-2;2*+1;;;;;;;;;; |
| InChIKey | CDMADVZSLOHIFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium borate (CHEBI:755954) has role ophthalmology drug (CHEBI:66981) |
| sodium borate (CHEBI:755954) is a oxoanion (CHEBI:35406) |
| Synonyms | Source |
|---|---|
| Borax glass | ChEMBL |
| Dehybor | ChEMBL |
| E-285 | ChEMBL |
| Fused borax | ChEMBL |
| Granubor | ChEMBL |
| INS-285 | ChEMBL |