EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2.C13H17N5O8S2 |
| Net Charge | 0 |
| Average Mass | 581.630 |
| Monoisotopic Mass | 581.15738 |
| SMILES | C[C@H]1[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2csc(N)n2)C(=O)N1S(=O)(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H17N5O8S2.C6H14N2O2/c1-5-7(10(20)18(5)28(23,24)25)16-9(19)8(6-4-27-12(14)15-6)17-26-13(2,3)11(21)22;7-4-2-1-3-5(8)6(9)10/h4-5,7H,1-3H3,(H2,14,15)(H,16,19)(H,21,22)(H,23,24,25);5H,1-4,7-8H2,(H,9,10)/b17-8-;/t5-,7-;5-/m00/s1 |
| InChIKey | KPPBAEVZLDHCOK-JHBYREIPSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aztreonam lysine (CHEBI:755932) is a monobactam (CHEBI:50695) |
| Synonyms | Source |
|---|---|
| Aztreonam l-lysine salt | ChEMBL |
| Aztreonam lysinate | ChEMBL |
| Corus 1020 | ChEMBL |
| CORUS-1020 | ChEMBL |
| CORUS1020 | ChEMBL |