EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2.C2H3Cl3O2 |
| Net Charge | 0 |
| Average Mass | 282.551 |
| Monoisotopic Mass | 280.99884 |
| SMILES | C[N+](C)(C)CC(=O)[O-].OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H11NO2.C2H3Cl3O2/c1-6(2,3)4-5(7)8;3-2(4,5)1(6)7/h4H2,1-3H3;1,6-7H |
| InChIKey | ONAOIDNSINNZOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloral betaine (CHEBI:755929) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| cloral betaina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5107 | ChEMBL |
| Chloral betaine | ChEMBL |
| Cloral betaine | ChEMBL |