EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13NO.C10H12N4O5.C9H9NO3.C9H9NO3.C9H9NO3.C5H13NO.C5H13NO |
| Net Charge | 0 |
| Average Mass | 1115.249 |
| Monoisotopic Mass | 1114.55464 |
| SMILES | CC(=O)Nc1ccc(C(=O)O)cc1.CC(=O)Nc1ccc(C(=O)O)cc1.CC(=O)Nc1ccc(C(=O)O)cc1.CC(O)CN(C)C.CC(O)CN(C)C.CC(O)CN(C)C.O=c1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N4O5.3C9H9NO3.3C5H13NO/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;3*1-6(11)10-8-4-2-7(3-5-8)9(12)13;3*1-5(7)4-6(2)3/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);3*2-5H,1H3,(H,10,11)(H,12,13);3*5,7H,4H2,1-3H3/t4-,6-,7-,10-;;;;;;/m1....../s1 |
| InChIKey | YLDCUKJMEKGGFI-QCSRICIXSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inosine pranobex (CHEBI:755923) has role antiviral agent (CHEBI:22587) |
| inosine pranobex (CHEBI:755923) is a purine nucleoside (CHEBI:26394) |
| Synonyms | Source |
|---|---|
| Delimmun | ChEMBL |
| Imunoviral | ChEMBL |
| Inosine acedobene dimepranol | ChEMBL |
| Inosine pranobex | ChEMBL |
| Inosiplex | ChEMBL |
| Isoprinosin | ChEMBL |
| Brand Names | Source |
|---|---|
| Aviral | ChEMBL |
| Imunovir | ChEMBL |