EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43N5O4 |
| Net Charge | 0 |
| Average Mass | 597.760 |
| Monoisotopic Mass | 597.33150 |
| SMILES | CN(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)C(=O)c1ccc(CN2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C35H43N5O4/c1-38(34(42)29-13-11-26(12-14-29)25-40-19-15-28(16-20-40)33(36)41)23-24-39-21-17-30(18-22-39)44-35(43)37-32-10-6-5-9-31(32)27-7-3-2-4-8-27/h2-14,28,30H,15-25H2,1H3,(H2,36,41)(H,37,43) |
| InChIKey | FYDWDCIFZSGNBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| revefenacin (CHEBI:755916) has role renoprotective agent (CHEBI:231911) |
| revefenacin (CHEBI:755916) is a piperidines (CHEBI:26151) |
| INNs | Source |
|---|---|
| revefenacina | WHO MedNet |
| revefenacine | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK-1160724 | ChEMBL |
| GSK1160724 | ChEMBL |
| Revefenacin | ChEMBL |
| TD-4208 | ChEMBL |
| Brand Name | Source |
|---|---|
| Yupelri | ChEMBL |