EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755904 - prethcamide
| Formula | C13H24N2O2.C12H22N2O2 |
| Net Charge | 0 |
| Average Mass | 466.667 |
| Monoisotopic Mass | 466.35191 |
| SMILES | C/C=C/C(=O)N(CC)C(CC)C(=O)N(C)C.C/C=C/C(=O)N(CCC)C(CC)C(=O)N(C)C |
| InChI | InChI=1S/C13H24N2O2.C12H22N2O2/c1-6-9-12(16)15(10-7-2)11(8-3)13(17)14(4)5;1-6-9-11(15)14(8-3)10(7-2)12(16)13(4)5/h6,9,11H,7-8,10H2,1-5H3;6,9-10H,7-8H2,1-5H3/b2*9-6+ |
| InChIKey | ZDHWSRRZUPRQBD-ACOOBTJJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prethcamide (CHEBI:755904) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Cropropamide combination with crotethamide | ChEMBL |
| G-5668 | ChEMBL |
| Gycoren | ChEMBL |
| Miconen | ChEMBL |
| Micoren | ChEMBL |
| Prethcamide | ChEMBL |