EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H62N2O4S |
| Net Charge | 0 |
| Average Mass | 691.035 |
| Monoisotopic Mass | 690.44303 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(NCCN5CCS(=O)(=O)CC5)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)C(c3ccc(C(=O)O)cc3)=CC[C@]21C |
| InChI | InChI=1S/C42H62N2O4S/c1-28(2)31-14-19-42(43-22-23-44-24-26-49(47,48)27-25-44)21-20-40(6)33(36(31)42)12-13-35-39(5)17-15-32(29-8-10-30(11-9-29)37(45)46)38(3,4)34(39)16-18-41(35,40)7/h8-11,15,31,33-36,43H,1,12-14,16-27H2,2-7H3,(H,45,46)/t31-,33+,34-,35+,36+,39-,40+,41+,42-/m0/s1 |
| InChIKey | XDMUFNNPLXHNKA-ZTESCHFWSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-955176 (CHEBI:755902) has role anti-HIV agent (CHEBI:64946) |
| bms-955176 (CHEBI:755902) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| BMS-955176 | ChEMBL |
| GSK-3532795 | ChEMBL |
| Citations |
|---|