EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16FN7O2S |
| Net Charge | 0 |
| Average Mass | 461.482 |
| Monoisotopic Mass | 461.10702 |
| SMILES | CN1C(=O)COc2c1cnc1ccc(Sc3nnc4c(F)cc(-c5cnn(C)c5)cn34)cc21 |
| InChI | InChI=1S/C22H16FN7O2S/c1-28-9-13(7-25-28)12-5-16(23)21-26-27-22(30(21)10-12)33-14-3-4-17-15(6-14)20-18(8-24-17)29(2)19(31)11-32-20/h3-10H,11H2,1-2H3 |
| InChIKey | MFEXYTURXUZOID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dalmelitinib (CHEBI:755896) has role antineoplastic agent (CHEBI:35610) |
| dalmelitinib (CHEBI:755896) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| dalmelitinib | WHO MedNet |
| Citations |
|---|