EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755894 - adh-1
| Formula | C22H34N8O6S2 |
| Net Charge | 0 |
| Average Mass | 570.698 |
| Monoisotopic Mass | 570.20427 |
| SMILES | [H][C@@]1(C(N)=O)CSSC[C@]([H])(NC(C)=O)C(=O)N[C@@H](Cc2cncn2)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1 |
| InChI | InChI=1S/C22H34N8O6S2/c1-10(2)17-22(36)29-15(18(23)32)7-37-38-8-16(27-12(4)31)21(35)28-14(5-13-6-24-9-25-13)20(34)26-11(3)19(33)30-17/h6,9-11,14-17H,5,7-8H2,1-4H3,(H2,23,32)(H,24,25)(H,26,34)(H,27,31)(H,28,35)(H,29,36)(H,30,33)/t11-,14-,15-,16-,17-/m0/s1 |
| InChIKey | FQVLRGLGWNWPSS-BXBUPLCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adh-1 (CHEBI:755894) has role antineoplastic agent (CHEBI:35610) |
| adh-1 (CHEBI:755894) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| Adh 1 | ChEMBL |
| Adh-1 | ChEMBL |
| Cys-his-ala-val-cys | ChEMBL |
| Exherin | ChEMBL |
| NSC-729477 | ChEMBL |
| Citations |
|---|