EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N8O2 |
| Net Charge | 0 |
| Average Mass | 382.428 |
| Monoisotopic Mass | 382.18657 |
| SMILES | CC1(C)OCCn2c1nc1c(N3CCOCC3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C18H22N8O2/c1-18(2)16-22-12-14(25-3-6-27-7-4-25)23-13(11-9-20-17(19)21-10-11)24-15(12)26(16)5-8-28-18/h9-10H,3-8H2,1-2H3,(H2,19,20,21) |
| InChIKey | LGWACEZVCMBSKW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paxalisib (CHEBI:755893) has role antineoplastic agent (CHEBI:35610) |
| paxalisib (CHEBI:755893) is a purines (CHEBI:26401) |
| INN | Source |
|---|---|
| paxalisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| G-02441729 | ChEMBL |
| G02441729 | ChEMBL |
| GDC-0084 | ChEMBL |
| GDC0084 | ChEMBL |
| Rg-7666 | ChEMBL |
| RG 7666 | ChEMBL |
| Citations |
|---|