EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755891 - bemcentinib
| Formula | C30H34N8 |
| Net Charge | 0 |
| Average Mass | 506.658 |
| Monoisotopic Mass | 506.29064 |
| SMILES | Nc1nc(Nc2ccc3c(c2)CC[C@@H](N2CCCC2)CC3)nn1-c1cc2c(nn1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C30H34N8/c31-29-33-30(32-24-13-10-20-11-14-25(15-12-22(20)18-24)37-16-3-4-17-37)36-38(29)27-19-23-8-5-7-21-6-1-2-9-26(21)28(23)35-34-27/h1-2,6,9-10,13,18-19,25H,3-5,7-8,11-12,14-17H2,(H3,31,32,33,36)/t25-/m0/s1 |
| InChIKey | KXMZDGSRSGHMMK-VWLOTQADSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bemcentinib (CHEBI:755891) has role antineoplastic agent (CHEBI:35610) |
| bemcentinib (CHEBI:755891) has role antiviral agent (CHEBI:22587) |
| bemcentinib (CHEBI:755891) is a pyridazines (CHEBI:37921) |
| INN | Source |
|---|---|
| bemcentinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BGB 324 | ChEMBL |
| BGB-324 | ChEMBL |
| BGB324 | ChEMBL |
| CS-1046 | ChEMBL |
| HY-15150 | ChEMBL |
| KB-80319 | ChEMBL |
| Citations |
|---|