EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3OC[C@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1 |
| InChIKey | OVMFOVNOXASTPA-VYUBKLCTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoschaftoside (CHEBI:75589) has functional parent apigenin (CHEBI:18388) |
| isoschaftoside (CHEBI:75589) has role metabolite (CHEBI:25212) |
| isoschaftoside (CHEBI:75589) is a C-glycosyl compound (CHEBI:20857) |
| isoschaftoside (CHEBI:75589) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]-6-[(2S,3R,4S,5S)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| apigenin 6-C-α-L-arabinopyranoside-8-C-β-D-glucopyranoside | LIPID MAPS |
| apigenin 6-C-arabinoside 8-C-glucoside | ChEBI |
| 6-C-α-L-arabinopyranosyl-8-C-β-D-glucosylapigenin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12110243 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1445782 | Reaxys |
| CAS:52012-29-0 | ChemIDplus |