EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26FN5O3 |
| Net Charge | 0 |
| Average Mass | 451.502 |
| Monoisotopic Mass | 451.20197 |
| SMILES | O=c1ccc2ccc(F)c3c2n1C[C@H]3CN1CCC(NCc2cc3c(nn2)OCCO3)CC1 |
| InChI | InChI=1S/C24H26FN5O3/c25-19-3-1-15-2-4-21(31)30-14-16(22(19)23(15)30)13-29-7-5-17(6-8-29)26-12-18-11-20-24(28-27-18)33-10-9-32-20/h1-4,11,16-17,26H,5-10,12-14H2/t16-/m1/s1 |
| InChIKey | SRICOHRDRMZREQ-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-945237 (CHEBI:755888) has role antiinfective agent (CHEBI:35441) |
| gsk-945237 (CHEBI:755888) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Gsk-945237 | ChEMBL |
| GSK945237 | ChEMBL |
| Citations |
|---|