EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31F9N4O5 |
| Net Charge | 0 |
| Average Mass | 722.605 |
| Monoisotopic Mass | 722.21507 |
| SMILES | CCOC(=O)N1c2ccc(C(F)(F)F)cc2[C@@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncc(OCCCC(=O)O)cn2)C[C@H]1CC |
| InChI | InChI=1S/C32H31F9N4O5/c1-3-22-14-26(24-13-19(30(33,34)35)7-8-25(24)45(22)29(48)49-4-2)44(28-42-15-23(16-43-28)50-9-5-6-27(46)47)17-18-10-20(31(36,37)38)12-21(11-18)32(39,40)41/h7-8,10-13,15-16,22,26H,3-6,9,14,17H2,1-2H3,(H,46,47)/t22-,26+/m1/s1 |
| InChIKey | NRWORBQAOQVYBJ-GJZUVCINSA-N |
| Roles Classification |
|---|
| Application: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obicetrapib (CHEBI:755887) has role antiatherosclerotic agent (CHEBI:145947) |
| obicetrapib (CHEBI:755887) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| obicetrapib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AMG-899 | ChEMBL |
| CASA | ChEMBL |
| DEZ-001 | ChEMBL |
| TA-8995 | ChEMBL |
| Citations |
|---|