EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N6O2S |
| Net Charge | 0 |
| Average Mass | 486.601 |
| Monoisotopic Mass | 486.18380 |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3)nc3ccsc23)c1 |
| InChI | InChI=1S/C26H26N6O2S/c1-3-23(33)27-19-5-4-6-21(17-19)34-25-24-22(11-16-35-24)29-26(30-25)28-18-7-9-20(10-8-18)32-14-12-31(2)13-15-32/h3-11,16-17H,1,12-15H2,2H3,(H,27,33)(H,28,29,30) |
| InChIKey | FDMQDKQUTRLUBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olmutinib (CHEBI:755885) has role antineoplastic agent (CHEBI:35610) |
| olmutinib (CHEBI:755885) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| BI 1482694 | ChEMBL |
| BI-1482694 | ChEMBL |
| HM-61713 | ChEMBL |
| HM61713 | ChEMBL |
| Olmutinib | ChEMBL |
| Citations |
|---|