EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31ClN6O2 |
| Net Charge | 0 |
| Average Mass | 495.027 |
| Monoisotopic Mass | 494.21970 |
| SMILES | Cc1cc(C(=O)Nc2nc3cccc(Cl)c3n2[C@@H]2CCCCN(C(=O)/C=C/CN(C)C)C2)ccn1 |
| InChI | InChI=1S/C26H31ClN6O2/c1-18-16-19(12-13-28-18)25(35)30-26-29-22-10-6-9-21(27)24(22)33(26)20-8-4-5-15-32(17-20)23(34)11-7-14-31(2)3/h6-7,9-13,16,20H,4-5,8,14-15,17H2,1-3H3,(H,29,30,35)/b11-7+/t20-/m1/s1 |
| InChIKey | IOMMMLWIABWRKL-WUTDNEBXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nazartinib (CHEBI:755884) has role antineoplastic agent (CHEBI:35610) |
| nazartinib (CHEBI:755884) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| nazartinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| EGF-816 | ChEMBL |
| EGF816 | ChEMBL |
| NVP-EGF816-NX | ChEMBL |
| Citations |
|---|