EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22FN7O3 |
| Net Charge | 0 |
| Average Mass | 463.473 |
| Monoisotopic Mass | 463.17682 |
| SMILES | COCCOc1cnc2ccn([C@H](C)c3nnc4c(F)cc(-c5cnn(C)c5)cn34)c(=O)c2c1 |
| InChI | InChI=1S/C23H22FN7O3/c1-14(30-5-4-20-18(23(30)32)9-17(11-25-20)34-7-6-33-3)21-27-28-22-19(24)8-15(13-31(21)22)16-10-26-29(2)12-16/h4-5,8-14H,6-7H2,1-3H3/t14-/m1/s1 |
| InChIKey | DWHXUGDWKAIASB-CQSZACIVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amg-337 (CHEBI:755883) has role antineoplastic agent (CHEBI:35610) |
| amg-337 (CHEBI:755883) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| Amg-337 | ChEMBL |
| AMG 337 | ChEMBL |
| Citations |
|---|